C50H68O5P+ — CID 123480923
[13-[6-(2-acetylperoxyethoxy)-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]-6,10-dimethyltridecan-2-yl]-triphenylphosphanium (PubChem CID 123480923) has the molecular formula C50H68O5P+ and a molecular weight of 780.06 g/mol. Its IUPAC name is [13-[6-(2-acetylperoxyethoxy)-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]-6,10-dimethyltridecan-2-yl]-triphenylphosphanium.
| Compound Name | [13-[6-(2-acetylperoxyethoxy)-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]-6,10-dimethyltridecan-2-yl]-triphenylphosphanium |
|---|---|
| PubChem CID | 123480923 |
| Molecular Formula | C50H68O5P+ |
| Molecular Weight | 780.06 g/mol |
| Exact Mass | 779.48 |
| IUPAC Name | [13-[6-(2-acetylperoxyethoxy)-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]-6,10-dimethyltridecan-2-yl]-triphenylphosphanium |
| SMILES | CC(=O)OOCCOc1c(C)c(C)c2c(c1C)CCC(C)(CCCC(C)CCCC(C)CCCC(C)[P+](c1ccccc1)(c1ccccc1)c1ccccc1)O2 |
| InChI | InChI=1S/C50H68O5P/c1-37(23-19-25-39(3)56(44-26-12-9-13-27-44,45-28-14-10-15-29-45)46-30-16-11-17-31-46)21-18-22-38(2)24-20-33-50(8)34-32-47-42(6)48(40(4)41(5)49(47)54-50)52-35-36-53-55-43(7)51/h9-17,26-31,37-39H,18-25,32-36H2,1-8H3/q+1 |
| InChIKey | SNBUZXVFSYGEID-UHFFFAOYSA-N |
| XLogP | 11.73 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.06 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|