About 4-hydroxy-3,6-dimethoxy-2-undec-10-enylcyclohexa-2,5-dien-1-one
4-hydroxy-3,6-dimethoxy-2-undec-10-enylcyclohexa-2,5-dien-1-one (PubChem CID 123481107) has the molecular formula C19H30O4
and a molecular weight of 322.45 g/mol. Its IUPAC name is 4-hydroxy-3,6-dimethoxy-2-undec-10-enylcyclohexa-2,5-dien-1-one.
Molecular Properties
| Compound Name | 4-hydroxy-3,6-dimethoxy-2-undec-10-enylcyclohexa-2,5-dien-1-one |
| PubChem CID | 123481107 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 4-hydroxy-3,6-dimethoxy-2-undec-10-enylcyclohexa-2,5-dien-1-one |
| SMILES | C=CCCCCCCCCCC1=C(OC)C(O)C=C(OC)C1=O |
| InChI | InChI=1S/C19H30O4/c1-4-5-6-7-8-9-10-11-12-13-15-18(21)17(22-2)14-16(20)19(15)23-3/h4,14,16,20H,1,5-13H2,2-3H3 |
| InChIKey | MKUWRJBLQIPBQF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-3,6-dimethoxy-2-undec-10-enylcyclohexa-2,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3,6-dimethoxy-2-undec-10-enylcyclohexa-2,5-dien-1-one?
The IUPAC name of 4-hydroxy-3,6-dimethoxy-2-undec-10-enylcyclohexa-2,5-dien-1-one (CID 123481107) is 4-hydroxy-3,6-dimethoxy-2-undec-10-enylcyclohexa-2,5-dien-1-one.
What is the SMILES notation for 4-hydroxy-3,6-dimethoxy-2-undec-10-enylcyclohexa-2,5-dien-1-one?
The canonical SMILES for 4-hydroxy-3,6-dimethoxy-2-undec-10-enylcyclohexa-2,5-dien-1-one is C=CCCCCCCCCCC1=C(OC)C(O)C=C(OC)C1=O.
What is the InChIKey of 4-hydroxy-3,6-dimethoxy-2-undec-10-enylcyclohexa-2,5-dien-1-one?
The InChIKey is MKUWRJBLQIPBQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O4/c1-4-5-6-7-8-9-10-11-12-13-15-18(21)17(22-2)14-16(20)19(15)23-3/h4,14,16,20H,1,5-13H2,2-3H3.
What are the key properties of 4-hydroxy-3,6-dimethoxy-2-undec-10-enylcyclohexa-2,5-dien-1-one?
4-hydroxy-3,6-dimethoxy-2-undec-10-enylcyclohexa-2,5-dien-1-one has a molecular weight of 322.45 g/mol, XLogP of 4.06, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3,6-dimethoxy-2-undec-10-enylcyclohexa-2,5-dien-1-one is sourced from PubChem (CID 123481107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).