About 2-[3-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-2-methylphenyl]-1,4-dimethylpyridin-1-ium
2-[3-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-2-methylphenyl]-1,4-dimethylpyridin-1-ium (PubChem CID 123481215) has the molecular formula C19H24N3+
and a molecular weight of 294.42 g/mol. Its IUPAC name is 2-[3-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-2-methylphenyl]-1,4-dimethylpyridin-1-ium.
Molecular Properties
| Compound Name | 2-[3-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-2-methylphenyl]-1,4-dimethylpyridin-1-ium |
| PubChem CID | 123481215 |
| Molecular Formula | C19H24N3+ |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 2-[3-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-2-methylphenyl]-1,4-dimethylpyridin-1-ium |
| SMILES | Cc1cc[n+](C)c(-c2cccc(N3C=CN(C)[C@@H]3C)c2C)c1 |
| InChI | InChI=1S/C19H24N3/c1-14-9-10-21(5)19(13-14)17-7-6-8-18(15(17)2)22-12-11-20(4)16(22)3/h6-13,16H,1-5H3/q+1/t16-/m0/s1 |
| InChIKey | FMNYXONXJFPHOF-INIZCTEOSA-N |
| XLogP | 3.36 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-2-methylphenyl]-1,4-dimethylpyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-2-methylphenyl]-1,4-dimethylpyridin-1-ium?
The IUPAC name of 2-[3-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-2-methylphenyl]-1,4-dimethylpyridin-1-ium (CID 123481215) is 2-[3-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-2-methylphenyl]-1,4-dimethylpyridin-1-ium.
What is the SMILES notation for 2-[3-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-2-methylphenyl]-1,4-dimethylpyridin-1-ium?
The canonical SMILES for 2-[3-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-2-methylphenyl]-1,4-dimethylpyridin-1-ium is Cc1cc[n+](C)c(-c2cccc(N3C=CN(C)[C@@H]3C)c2C)c1.
What is the InChIKey of 2-[3-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-2-methylphenyl]-1,4-dimethylpyridin-1-ium?
The InChIKey is FMNYXONXJFPHOF-INIZCTEOSA-N. The full InChI is InChI=1S/C19H24N3/c1-14-9-10-21(5)19(13-14)17-7-6-8-18(15(17)2)22-12-11-20(4)16(22)3/h6-13,16H,1-5H3/q+1/t16-/m0/s1.
What are the key properties of 2-[3-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-2-methylphenyl]-1,4-dimethylpyridin-1-ium?
2-[3-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-2-methylphenyl]-1,4-dimethylpyridin-1-ium has a molecular weight of 294.42 g/mol, XLogP of 3.36, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-2-methylphenyl]-1,4-dimethylpyridin-1-ium is sourced from PubChem (CID 123481215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).