C19H24N3+ — CID 123481215
2-[3-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-2-methylphenyl]-1,4-dimethylpyridin-1-ium (PubChem CID 123481215) has the molecular formula C19H24N3+ and a molecular weight of 294.42 g/mol. Its IUPAC name is 2-[3-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-2-methylphenyl]-1,4-dimethylpyridin-1-ium.
| Compound Name | 2-[3-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-2-methylphenyl]-1,4-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 123481215 |
| Molecular Formula | C19H24N3+ |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 2-[3-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-2-methylphenyl]-1,4-dimethylpyridin-1-ium |
| SMILES | Cc1cc[n+](C)c(-c2cccc(N3C=CN(C)[C@@H]3C)c2C)c1 |
| InChI | InChI=1S/C19H24N3/c1-14-9-10-21(5)19(13-14)17-7-6-8-18(15(17)2)22-12-11-20(4)16(22)3/h6-13,16H,1-5H3/q+1/t16-/m0/s1 |
| InChIKey | FMNYXONXJFPHOF-INIZCTEOSA-N |
| XLogP | 3.36 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|