C12H18F3N3 — CID 123481258
N-(2-ethyl-2-methylbutyl)-5-(trifluoromethyl)pyrazin-2-amine (PubChem CID 123481258) has the molecular formula C12H18F3N3 and a molecular weight of 261.29 g/mol. Its IUPAC name is N-(2-ethyl-2-methylbutyl)-5-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | N-(2-ethyl-2-methylbutyl)-5-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 123481258 |
| Molecular Formula | C12H18F3N3 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N-(2-ethyl-2-methylbutyl)-5-(trifluoromethyl)pyrazin-2-amine |
| SMILES | CCC(C)(CC)CNc1cnc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C12H18F3N3/c1-4-11(3,5-2)8-18-10-7-16-9(6-17-10)12(13,14)15/h6-7H,4-5,8H2,1-3H3,(H,17,18) |
| InChIKey | PLJXXLBPGCCCKX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |