About 2-(2,5-difluorohexa-2,4-dien-3-yl)piperidine
2-(2,5-difluorohexa-2,4-dien-3-yl)piperidine (PubChem CID 123481461) has the molecular formula C11H17F2N
and a molecular weight of 201.26 g/mol. Its IUPAC name is 2-(2,5-difluorohexa-2,4-dien-3-yl)piperidine.
Molecular Properties
| Compound Name | 2-(2,5-difluorohexa-2,4-dien-3-yl)piperidine |
| PubChem CID | 123481461 |
| Molecular Formula | C11H17F2N |
| Molecular Weight | 201.26 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 2-(2,5-difluorohexa-2,4-dien-3-yl)piperidine |
| SMILES | CC(F)=CC(=C(C)F)C1CCCCN1 |
| InChI | InChI=1S/C11H17F2N/c1-8(12)7-10(9(2)13)11-5-3-4-6-14-11/h7,11,14H,3-6H2,1-2H3 |
| InChIKey | BYAUZYWCAQWHGJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-difluorohexa-2,4-dien-3-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-difluorohexa-2,4-dien-3-yl)piperidine?
The IUPAC name of 2-(2,5-difluorohexa-2,4-dien-3-yl)piperidine (CID 123481461) is 2-(2,5-difluorohexa-2,4-dien-3-yl)piperidine.
What is the SMILES notation for 2-(2,5-difluorohexa-2,4-dien-3-yl)piperidine?
The canonical SMILES for 2-(2,5-difluorohexa-2,4-dien-3-yl)piperidine is CC(F)=CC(=C(C)F)C1CCCCN1.
What is the InChIKey of 2-(2,5-difluorohexa-2,4-dien-3-yl)piperidine?
The InChIKey is BYAUZYWCAQWHGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2N/c1-8(12)7-10(9(2)13)11-5-3-4-6-14-11/h7,11,14H,3-6H2,1-2H3.
What are the key properties of 2-(2,5-difluorohexa-2,4-dien-3-yl)piperidine?
2-(2,5-difluorohexa-2,4-dien-3-yl)piperidine has a molecular weight of 201.26 g/mol, XLogP of 3.25, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-difluorohexa-2,4-dien-3-yl)piperidine is sourced from PubChem (CID 123481461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).