C11H17NO — CID 123481761
2,3-dimethyl-4a,5,6,7,8,8a-hexahydro-3H-quinolin-4-one (PubChem CID 123481761) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 2,3-dimethyl-4a,5,6,7,8,8a-hexahydro-3H-quinolin-4-one.
| Compound Name | 2,3-dimethyl-4a,5,6,7,8,8a-hexahydro-3H-quinolin-4-one |
|---|---|
| PubChem CID | 123481761 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 2,3-dimethyl-4a,5,6,7,8,8a-hexahydro-3H-quinolin-4-one |
| SMILES | CC1=NC2CCCCC2C(=O)C1C |
| InChI | InChI=1S/C11H17NO/c1-7-8(2)12-10-6-4-3-5-9(10)11(7)13/h7,9-10H,3-6H2,1-2H3 |
| InChIKey | DAZAOZVCOMZVOH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |