C9H16N2O2 — CID 123482256
5,6-dimethyl-1-propyl-1,3-diazinane-2,4-dione (PubChem CID 123482256) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 5,6-dimethyl-1-propyl-1,3-diazinane-2,4-dione.
| Compound Name | 5,6-dimethyl-1-propyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 123482256 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 5,6-dimethyl-1-propyl-1,3-diazinane-2,4-dione |
| SMILES | CCCN1C(=O)NC(=O)C(C)C1C |
| InChI | InChI=1S/C9H16N2O2/c1-4-5-11-7(3)6(2)8(12)10-9(11)13/h6-7H,4-5H2,1-3H3,(H,10,12,13) |
| InChIKey | SFUURFNFXOFUGW-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |