C30H37FN4O — CID 123483050
N-[[(1R,2R)-2-[[4-(6-fluoro-2H-indazol-3-yl)piperidin-1-yl]methyl]cyclohexyl]methyl]-3-(2-methylphenyl)prop-2-enamide (PubChem CID 123483050) has the molecular formula C30H37FN4O and a molecular weight of 488.65 g/mol. Its IUPAC name is N-[[(1R,2R)-2-[[4-(6-fluoro-2H-indazol-3-yl)piperidin-1-yl]methyl]cyclohexyl]methyl]-3-(2-methylphenyl)prop-2-enamide.
| Compound Name | N-[[(1R,2R)-2-[[4-(6-fluoro-2H-indazol-3-yl)piperidin-1-yl]methyl]cyclohexyl]methyl]-3-(2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 123483050 |
| Molecular Formula | C30H37FN4O |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | N-[[(1R,2R)-2-[[4-(6-fluoro-2H-indazol-3-yl)piperidin-1-yl]methyl]cyclohexyl]methyl]-3-(2-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccccc1C=CC(=O)NC[C@@H]1CCCC[C@H]1CN1CCC(c2[nH]nc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C30H37FN4O/c1-21-6-2-3-7-22(21)10-13-29(36)32-19-24-8-4-5-9-25(24)20-35-16-14-23(15-17-35)30-27-12-11-26(31)18-28(27)33-34-30/h2-3,6-7,10-13,18,23-25H,4-5,8-9,14-17,19-20H2,1H3,(H,32,36)(H,33,34)/t24-,25-/m0/s1 |
| InChIKey | SQYROTHXSBTHGE-DQEYMECFSA-N |
| XLogP | 5.83 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|