C8H13NO2 — CID 123483339
3,4,5-trimethyl-6-methylidene-1,3-oxazinan-2-one (PubChem CID 123483339) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is 3,4,5-trimethyl-6-methylidene-1,3-oxazinan-2-one.
| Compound Name | 3,4,5-trimethyl-6-methylidene-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 123483339 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 3,4,5-trimethyl-6-methylidene-1,3-oxazinan-2-one |
| SMILES | C=C1OC(=O)N(C)C(C)C1C |
| InChI | InChI=1S/C8H13NO2/c1-5-6(2)9(4)8(10)11-7(5)3/h5-6H,3H2,1-2,4H3 |
| InChIKey | OVZVBITURSQNPL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |