C16H21F7O — CID 123483501
2-[difluoro-(3,4,5-trifluorocyclohexyl)oxymethyl]-1,3-difluoro-5-prop-1-enylcyclohexane (PubChem CID 123483501) has the molecular formula C16H21F7O and a molecular weight of 362.33 g/mol. Its IUPAC name is 2-[difluoro-(3,4,5-trifluorocyclohexyl)oxymethyl]-1,3-difluoro-5-prop-1-enylcyclohexane.
| Compound Name | 2-[difluoro-(3,4,5-trifluorocyclohexyl)oxymethyl]-1,3-difluoro-5-prop-1-enylcyclohexane |
|---|---|
| PubChem CID | 123483501 |
| Molecular Formula | C16H21F7O |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2-[difluoro-(3,4,5-trifluorocyclohexyl)oxymethyl]-1,3-difluoro-5-prop-1-enylcyclohexane |
| SMILES | CC=CC1CC(F)C(C(F)(F)OC2CC(F)C(F)C(F)C2)C(F)C1 |
| InChI | InChI=1S/C16H21F7O/c1-2-3-8-4-10(17)14(11(18)5-8)16(22,23)24-9-6-12(19)15(21)13(20)7-9/h2-3,8-15H,4-7H2,1H3 |
| InChIKey | YLAVOYNOGQNVHN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|