About 2,2-difluoro-9-methoxy-8,8-dimethylnon-3-ene
2,2-difluoro-9-methoxy-8,8-dimethylnon-3-ene (PubChem CID 123484096) has the molecular formula C12H22F2O
and a molecular weight of 220.30 g/mol. Its IUPAC name is 2,2-difluoro-9-methoxy-8,8-dimethylnon-3-ene.
Molecular Properties
| Compound Name | 2,2-difluoro-9-methoxy-8,8-dimethylnon-3-ene |
| PubChem CID | 123484096 |
| Molecular Formula | C12H22F2O |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 2,2-difluoro-9-methoxy-8,8-dimethylnon-3-ene |
| SMILES | COCC(C)(C)CCCC=CC(C)(F)F |
| InChI | InChI=1S/C12H22F2O/c1-11(2,10-15-4)8-6-5-7-9-12(3,13)14/h7,9H,5-6,8,10H2,1-4H3 |
| InChIKey | OXOJDTMEJXKPMD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoro-9-methoxy-8,8-dimethylnon-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-9-methoxy-8,8-dimethylnon-3-ene?
The IUPAC name of 2,2-difluoro-9-methoxy-8,8-dimethylnon-3-ene (CID 123484096) is 2,2-difluoro-9-methoxy-8,8-dimethylnon-3-ene.
What is the SMILES notation for 2,2-difluoro-9-methoxy-8,8-dimethylnon-3-ene?
The canonical SMILES for 2,2-difluoro-9-methoxy-8,8-dimethylnon-3-ene is COCC(C)(C)CCCC=CC(C)(F)F.
What is the InChIKey of 2,2-difluoro-9-methoxy-8,8-dimethylnon-3-ene?
The InChIKey is OXOJDTMEJXKPMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F2O/c1-11(2,10-15-4)8-6-5-7-9-12(3,13)14/h7,9H,5-6,8,10H2,1-4H3.
What are the key properties of 2,2-difluoro-9-methoxy-8,8-dimethylnon-3-ene?
2,2-difluoro-9-methoxy-8,8-dimethylnon-3-ene has a molecular weight of 220.30 g/mol, XLogP of 4.04, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-9-methoxy-8,8-dimethylnon-3-ene is sourced from PubChem (CID 123484096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).