C22H38O8 — CID 123484172
[2-(2-ethoxyethoxy)-2-(2,2,4-trimethyl-3-oxopentanoyl)oxyethyl] 2,2,4-trimethyl-3-oxopentanoate (PubChem CID 123484172) has the molecular formula C22H38O8 and a molecular weight of 430.54 g/mol. Its IUPAC name is [2-(2-ethoxyethoxy)-2-(2,2,4-trimethyl-3-oxopentanoyl)oxyethyl] 2,2,4-trimethyl-3-oxopentanoate.
| Compound Name | [2-(2-ethoxyethoxy)-2-(2,2,4-trimethyl-3-oxopentanoyl)oxyethyl] 2,2,4-trimethyl-3-oxopentanoate |
|---|---|
| PubChem CID | 123484172 |
| Molecular Formula | C22H38O8 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | [2-(2-ethoxyethoxy)-2-(2,2,4-trimethyl-3-oxopentanoyl)oxyethyl] 2,2,4-trimethyl-3-oxopentanoate |
| SMILES | CCOCCOC(COC(=O)C(C)(C)C(=O)C(C)C)OC(=O)C(C)(C)C(=O)C(C)C |
| InChI | InChI=1S/C22H38O8/c1-10-27-11-12-28-16(30-20(26)22(8,9)18(24)15(4)5)13-29-19(25)21(6,7)17(23)14(2)3/h14-16H,10-13H2,1-9H3 |
| InChIKey | WAAVLLYLWTVOBX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|