C20H34O4Si — CID 123484490
6-[8-[tert-butyl(dimethyl)silyl]oxyocta-2,4-dien-2-yl]-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 123484490) has the molecular formula C20H34O4Si and a molecular weight of 366.57 g/mol. Its IUPAC name is 6-[8-[tert-butyl(dimethyl)silyl]oxyocta-2,4-dien-2-yl]-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[8-[tert-butyl(dimethyl)silyl]oxyocta-2,4-dien-2-yl]-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 123484490 |
| Molecular Formula | C20H34O4Si |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 6-[8-[tert-butyl(dimethyl)silyl]oxyocta-2,4-dien-2-yl]-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | CC(=CC=CCCCO[Si](C)(C)C(C)(C)C)C1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C20H34O4Si/c1-16(17-15-18(21)24-20(5,6)23-17)13-11-9-10-12-14-22-25(7,8)19(2,3)4/h9,11,13,15H,10,12,14H2,1-8H3 |
| InChIKey | VRUARARNVUKACE-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|