About 5-(3,4-dihydropyridin-2-ylsulfanyl)hexanamide
5-(3,4-dihydropyridin-2-ylsulfanyl)hexanamide (PubChem CID 123484869) has the molecular formula C11H18N2OS
and a molecular weight of 226.34 g/mol. Its IUPAC name is 5-(3,4-dihydropyridin-2-ylsulfanyl)hexanamide.
Molecular Properties
| Compound Name | 5-(3,4-dihydropyridin-2-ylsulfanyl)hexanamide |
| PubChem CID | 123484869 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 5-(3,4-dihydropyridin-2-ylsulfanyl)hexanamide |
| SMILES | CC(CCCC(N)=O)SC1=NC=CCC1 |
| InChI | InChI=1S/C11H18N2OS/c1-9(5-4-6-10(12)14)15-11-7-2-3-8-13-11/h3,8-9H,2,4-7H2,1H3,(H2,12,14) |
| InChIKey | FTZBGPLUUQXREI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(3,4-dihydropyridin-2-ylsulfanyl)hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dihydropyridin-2-ylsulfanyl)hexanamide?
The IUPAC name of 5-(3,4-dihydropyridin-2-ylsulfanyl)hexanamide (CID 123484869) is 5-(3,4-dihydropyridin-2-ylsulfanyl)hexanamide.
What is the SMILES notation for 5-(3,4-dihydropyridin-2-ylsulfanyl)hexanamide?
The canonical SMILES for 5-(3,4-dihydropyridin-2-ylsulfanyl)hexanamide is CC(CCCC(N)=O)SC1=NC=CCC1.
What is the InChIKey of 5-(3,4-dihydropyridin-2-ylsulfanyl)hexanamide?
The InChIKey is FTZBGPLUUQXREI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2OS/c1-9(5-4-6-10(12)14)15-11-7-2-3-8-13-11/h3,8-9H,2,4-7H2,1H3,(H2,12,14).
What are the key properties of 5-(3,4-dihydropyridin-2-ylsulfanyl)hexanamide?
5-(3,4-dihydropyridin-2-ylsulfanyl)hexanamide has a molecular weight of 226.34 g/mol, XLogP of 2.47, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dihydropyridin-2-ylsulfanyl)hexanamide is sourced from PubChem (CID 123484869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).