C23H24N5O4+ — CID 123484872
(5-anilino-1,3,4-oxadiazol-2-yl)methyl-[4-(2-carboxy-6-azaspiro[2.5]octan-6-yl)phenyl]-oxoazanium (PubChem CID 123484872) has the molecular formula C23H24N5O4+ and a molecular weight of 434.48 g/mol. Its IUPAC name is (5-anilino-1,3,4-oxadiazol-2-yl)methyl-[4-(2-carboxy-6-azaspiro[2.5]octan-6-yl)phenyl]-oxoazanium.
| Compound Name | (5-anilino-1,3,4-oxadiazol-2-yl)methyl-[4-(2-carboxy-6-azaspiro[2.5]octan-6-yl)phenyl]-oxoazanium |
|---|---|
| PubChem CID | 123484872 |
| Molecular Formula | C23H24N5O4+ |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | (5-anilino-1,3,4-oxadiazol-2-yl)methyl-[4-(2-carboxy-6-azaspiro[2.5]octan-6-yl)phenyl]-oxoazanium |
| SMILES | O=C(O)C1CC12CCN(c1ccc([N+](=O)Cc3nnc(Nc4ccccc4)o3)cc1)CC2 |
| InChI | InChI=1S/C23H23N5O4/c29-21(30)19-14-23(19)10-12-27(13-11-23)17-6-8-18(9-7-17)28(31)15-20-25-26-22(32-20)24-16-4-2-1-3-5-16/h1-9,19H,10-15H2,(H-,24,26,29,30)/p+1 |
| InChIKey | CMYZQXHAVXGFCT-UHFFFAOYSA-O |
| XLogP | 4.11 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|