C38H67N11O15 — CID 123485069
N-(2-aminoethyl)-6-[bis[[1-[2-[2-[3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethyl]triazol-4-yl]methyl]amino]hexanamide (PubChem CID 123485069) has the molecular formula C38H67N11O15 and a molecular weight of 918.02 g/mol. Its IUPAC name is N-(2-aminoethyl)-6-[bis[[1-[2-[2-[3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethyl]triazol-4-yl]methyl]amino]hexanamide.
| Compound Name | N-(2-aminoethyl)-6-[bis[[1-[2-[2-[3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethyl]triazol-4-yl]methyl]amino]hexanamide |
|---|---|
| PubChem CID | 123485069 |
| Molecular Formula | C38H67N11O15 |
| Molecular Weight | 918.02 g/mol |
| Exact Mass | 917.48 |
| IUPAC Name | N-(2-aminoethyl)-6-[bis[[1-[2-[2-[3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethyl]triazol-4-yl]methyl]amino]hexanamide |
| SMILES | CC(=O)NC1C(OCCOCCn2cc(CN(CCCCCC(=O)NCCN)Cc3cn(CCOCCOC4OC(CO)C(O)C(O)C4NC(C)=O)nn3)nn2)OC(CO)C(O)C1O |
| InChI | InChI=1S/C38H67N11O15/c1-24(52)41-31-35(57)33(55)28(22-50)63-37(31)61-16-14-59-12-10-48-20-26(43-45-48)18-47(9-5-3-4-6-30(54)40-8-7-39)19-27-21-49(46-44-27)11-13-60-15-17-62-38-32(42-25(2)53)36(58)34(56)29(23-51)64-38/h20-21,28-29,31-38,50-51,55-58H,3-19,22-23,39H2,1-2H3,(H,40,54)(H,41,52)(H,42,53) |
| InChIKey | GZPSLKAJQGGGGD-UHFFFAOYSA-N |
| XLogP | -5.54 |
| TPSA | 354.74 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 23 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.02 |
| LogP ≤ 5 | -5.54 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 23 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|