C21H32OS — CID 123486559
1-sulfanylhenicosa-3,6,9,12,15,18-hexaen-1-ol (PubChem CID 123486559) has the molecular formula C21H32OS and a molecular weight of 332.55 g/mol. Its IUPAC name is 1-sulfanylhenicosa-3,6,9,12,15,18-hexaen-1-ol.
| Compound Name | 1-sulfanylhenicosa-3,6,9,12,15,18-hexaen-1-ol |
|---|---|
| PubChem CID | 123486559 |
| Molecular Formula | C21H32OS |
| Molecular Weight | 332.55 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 1-sulfanylhenicosa-3,6,9,12,15,18-hexaen-1-ol |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCC(O)S |
| InChI | InChI=1S/C21H32OS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)23/h3-4,6-7,9-10,12-13,15-16,18-19,21-23H,2,5,8,11,14,17,20H2,1H3 |
| InChIKey | RWAIFPASJLOMSB-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.55 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|