About N-(2-bromohepta-1,3,6-trien-3-yl)acetamide
N-(2-bromohepta-1,3,6-trien-3-yl)acetamide (PubChem CID 123486712) has the molecular formula C9H12BrNO
and a molecular weight of 230.10 g/mol. Its IUPAC name is N-(2-bromohepta-1,3,6-trien-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(2-bromohepta-1,3,6-trien-3-yl)acetamide |
| PubChem CID | 123486712 |
| Molecular Formula | C9H12BrNO |
| Molecular Weight | 230.10 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | N-(2-bromohepta-1,3,6-trien-3-yl)acetamide |
| SMILES | C=CCC=C(NC(C)=O)C(=C)Br |
| InChI | InChI=1S/C9H12BrNO/c1-4-5-6-9(7(2)10)11-8(3)12/h4,6H,1-2,5H2,3H3,(H,11,12) |
| InChIKey | ZQVLADUMBUWAEB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.10 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-bromohepta-1,3,6-trien-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromohepta-1,3,6-trien-3-yl)acetamide?
The IUPAC name of N-(2-bromohepta-1,3,6-trien-3-yl)acetamide (CID 123486712) is N-(2-bromohepta-1,3,6-trien-3-yl)acetamide.
What is the SMILES notation for N-(2-bromohepta-1,3,6-trien-3-yl)acetamide?
The canonical SMILES for N-(2-bromohepta-1,3,6-trien-3-yl)acetamide is C=CCC=C(NC(C)=O)C(=C)Br.
What is the InChIKey of N-(2-bromohepta-1,3,6-trien-3-yl)acetamide?
The InChIKey is ZQVLADUMBUWAEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrNO/c1-4-5-6-9(7(2)10)11-8(3)12/h4,6H,1-2,5H2,3H3,(H,11,12).
What are the key properties of N-(2-bromohepta-1,3,6-trien-3-yl)acetamide?
N-(2-bromohepta-1,3,6-trien-3-yl)acetamide has a molecular weight of 230.10 g/mol, XLogP of 2.49, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromohepta-1,3,6-trien-3-yl)acetamide is sourced from PubChem (CID 123486712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).