C27H30N2 — CID 123486796
9-tert-butyl-16,18-diethyl-17-methylidene-1,8-diazahexacyclo[9.7.2.02,7.08,19.015,20.016,18]icosa-2,4,6,9,11(20),12,14-heptaene (PubChem CID 123486796) has the molecular formula C27H30N2 and a molecular weight of 382.55 g/mol. Its IUPAC name is 9-tert-butyl-16,18-diethyl-17-methylidene-1,8-diazahexacyclo[9.7.2.02,7.08,19.015,20.016,18]icosa-2,4,6,9,11(20),12,14-heptaene.
| Compound Name | 9-tert-butyl-16,18-diethyl-17-methylidene-1,8-diazahexacyclo[9.7.2.02,7.08,19.015,20.016,18]icosa-2,4,6,9,11(20),12,14-heptaene |
|---|---|
| PubChem CID | 123486796 |
| Molecular Formula | C27H30N2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 9-tert-butyl-16,18-diethyl-17-methylidene-1,8-diazahexacyclo[9.7.2.02,7.08,19.015,20.016,18]icosa-2,4,6,9,11(20),12,14-heptaene |
| SMILES | C=C1C2(CC)c3cccc4c3C3N(C(C(C)(C)C)=C4)c4ccccc4N3C12CC |
| InChI | InChI=1S/C27H30N2/c1-7-26-17(3)27(26,8-2)29-21-15-10-9-14-20(21)28-22(25(4,5)6)16-18-12-11-13-19(26)23(18)24(28)29/h9-16,24H,3,7-8H2,1-2,4-6H3 |
| InChIKey | GDMQKVXPCXSFLH-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|