C37H45N4O6+ — CID 123487362
4-[[3,3-dimethyl-1-(3-methylbutyl)-7-nitroindol-1-ium-2-yl]methylidene]-2-[[3,3-dimethyl-1-(3-methylbutyl)-7-nitroindol-2-ylidene]methyl]-3-methoxycyclobut-2-en-1-one (PubChem CID 123487362) has the molecular formula C37H45N4O6+ and a molecular weight of 641.79 g/mol. Its IUPAC name is 4-[[3,3-dimethyl-1-(3-methylbutyl)-7-nitroindol-1-ium-2-yl]methylidene]-2-[[3,3-dimethyl-1-(3-methylbutyl)-7-nitroindol-2-ylidene]methyl]-3-methoxycyclobut-2-en-1-one.
| Compound Name | 4-[[3,3-dimethyl-1-(3-methylbutyl)-7-nitroindol-1-ium-2-yl]methylidene]-2-[[3,3-dimethyl-1-(3-methylbutyl)-7-nitroindol-2-ylidene]methyl]-3-methoxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 123487362 |
| Molecular Formula | C37H45N4O6+ |
| Molecular Weight | 641.79 g/mol |
| Exact Mass | 641.33 |
| IUPAC Name | 4-[[3,3-dimethyl-1-(3-methylbutyl)-7-nitroindol-1-ium-2-yl]methylidene]-2-[[3,3-dimethyl-1-(3-methylbutyl)-7-nitroindol-2-ylidene]methyl]-3-methoxycyclobut-2-en-1-one |
| SMILES | COC1=C(C=C2N(CCC(C)C)c3c([N+](=O)[O-])cccc3C2(C)C)C(=O)C1=CC1=[N+](CCC(C)C)c2c([N+](=O)[O-])cccc2C1(C)C |
| InChI | InChI=1S/C37H45N4O6/c1-22(2)16-18-38-30(36(5,6)26-12-10-14-28(32(26)38)40(43)44)20-24-34(42)25(35(24)47-9)21-31-37(7,8)27-13-11-15-29(41(45)46)33(27)39(31)19-17-23(3)4/h10-15,20-23H,16-19H2,1-9H3/q+1 |
| InChIKey | NZIKENXFXJUBQE-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 118.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.79 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|