About 3-propylnona-3,6-dienedial
3-propylnona-3,6-dienedial (PubChem CID 123487393) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 3-propylnona-3,6-dienedial.
Molecular Properties
| Compound Name | 3-propylnona-3,6-dienedial |
| PubChem CID | 123487393 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 3-propylnona-3,6-dienedial |
| SMILES | CCCC(=CCC=CCC=O)CC=O |
| InChI | InChI=1S/C12H18O2/c1-2-7-12(9-11-14)8-5-3-4-6-10-13/h3-4,8,10-11H,2,5-7,9H2,1H3 |
| InChIKey | YDDUXKOSCIZSGS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-propylnona-3,6-dienedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propylnona-3,6-dienedial?
The IUPAC name of 3-propylnona-3,6-dienedial (CID 123487393) is 3-propylnona-3,6-dienedial.
What is the SMILES notation for 3-propylnona-3,6-dienedial?
The canonical SMILES for 3-propylnona-3,6-dienedial is CCCC(=CCC=CCC=O)CC=O.
What is the InChIKey of 3-propylnona-3,6-dienedial?
The InChIKey is YDDUXKOSCIZSGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-2-7-12(9-11-14)8-5-3-4-6-10-13/h3-4,8,10-11H,2,5-7,9H2,1H3.
What are the key properties of 3-propylnona-3,6-dienedial?
3-propylnona-3,6-dienedial has a molecular weight of 194.27 g/mol, XLogP of 2.84, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propylnona-3,6-dienedial is sourced from PubChem (CID 123487393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).