C38H64F3NO — CID 123487968
[3-(4,7-dimethyl-3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl)-4,5-dimethylcyclohexyl]-[[4-[2-(4-ethylcyclohexyl)ethyl]-3-(trifluoromethyl)cyclohexyl]amino]methanol (PubChem CID 123487968) has the molecular formula C38H64F3NO and a molecular weight of 607.93 g/mol. Its IUPAC name is [3-(4,7-dimethyl-3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl)-4,5-dimethylcyclohexyl]-[[4-[2-(4-ethylcyclohexyl)ethyl]-3-(trifluoromethyl)cyclohexyl]amino]methanol.
| Compound Name | [3-(4,7-dimethyl-3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl)-4,5-dimethylcyclohexyl]-[[4-[2-(4-ethylcyclohexyl)ethyl]-3-(trifluoromethyl)cyclohexyl]amino]methanol |
|---|---|
| PubChem CID | 123487968 |
| Molecular Formula | C38H64F3NO |
| Molecular Weight | 607.93 g/mol |
| Exact Mass | 607.49 |
| IUPAC Name | [3-(4,7-dimethyl-3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl)-4,5-dimethylcyclohexyl]-[[4-[2-(4-ethylcyclohexyl)ethyl]-3-(trifluoromethyl)cyclohexyl]amino]methanol |
| SMILES | CCC1CCC(CCC2CCC(NC(O)C3CC(C)C(C)C(C4=CCC(C)C5CCC(C)CC45)C3)CC2C(F)(F)F)CC1 |
| InChI | InChI=1S/C38H64F3NO/c1-6-27-9-11-28(12-10-27)13-14-29-15-16-31(22-36(29)38(39,40)41)42-37(43)30-20-25(4)26(5)34(21-30)33-18-8-24(3)32-17-7-23(2)19-35(32)33/h18,23-32,34-37,42-43H,6-17,19-22H2,1-5H3 |
| InChIKey | IOEDJKJQYBPWOJ-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.93 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|