About 5-ethenylpiperidin-2-one
5-ethenylpiperidin-2-one (PubChem CID 123488227) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is 5-ethenylpiperidin-2-one.
Molecular Properties
| Compound Name | 5-ethenylpiperidin-2-one |
| PubChem CID | 123488227 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 5-ethenylpiperidin-2-one |
| SMILES | C=CC1CCC(=O)NC1 |
| InChI | InChI=1S/C7H11NO/c1-2-6-3-4-7(9)8-5-6/h2,6H,1,3-5H2,(H,8,9) |
| InChIKey | JQQLJUJPAMMBGK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenylpiperidin-2-one?
The IUPAC name of 5-ethenylpiperidin-2-one (CID 123488227) is 5-ethenylpiperidin-2-one.
What is the SMILES notation for 5-ethenylpiperidin-2-one?
The canonical SMILES for 5-ethenylpiperidin-2-one is C=CC1CCC(=O)NC1.
What is the InChIKey of 5-ethenylpiperidin-2-one?
The InChIKey is JQQLJUJPAMMBGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO/c1-2-6-3-4-7(9)8-5-6/h2,6H,1,3-5H2,(H,8,9).
What are the key properties of 5-ethenylpiperidin-2-one?
5-ethenylpiperidin-2-one has a molecular weight of 125.17 g/mol, XLogP of 0.70, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenylpiperidin-2-one is sourced from PubChem (CID 123488227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).