C23H27F6N3O2 — CID 123488974
N-[[1-(2-methanimidoylcyclohexanecarbonyl)piperidin-4-yl]methyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 123488974) has the molecular formula C23H27F6N3O2 and a molecular weight of 491.48 g/mol. Its IUPAC name is N-[[1-(2-methanimidoylcyclohexanecarbonyl)piperidin-4-yl]methyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[[1-(2-methanimidoylcyclohexanecarbonyl)piperidin-4-yl]methyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 123488974 |
| Molecular Formula | C23H27F6N3O2 |
| Molecular Weight | 491.48 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | N-[[1-(2-methanimidoylcyclohexanecarbonyl)piperidin-4-yl]methyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | [H]/N=C/C1CCCCC1C(=O)N1CCC(CNC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C23H27F6N3O2/c24-22(25,26)17-9-16(10-18(11-17)23(27,28)29)20(33)31-13-14-5-7-32(8-6-14)21(34)19-4-2-1-3-15(19)12-30/h9-12,14-15,19,30H,1-8,13H2,(H,31,33)/b30-12+ |
| InChIKey | LEKJGGIRMKHSAW-PNQUVVCRSA-N |
| XLogP | 5.15 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|