C20H18N4O2 — CID 123489231
(2R,4R)-N-(4-cyanophenyl)-4-[(4-isocyanophenyl)methoxy]pyrrolidine-2-carboxamide (PubChem CID 123489231) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is (2R,4R)-N-(4-cyanophenyl)-4-[(4-isocyanophenyl)methoxy]pyrrolidine-2-carboxamide.
| Compound Name | (2R,4R)-N-(4-cyanophenyl)-4-[(4-isocyanophenyl)methoxy]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 123489231 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (2R,4R)-N-(4-cyanophenyl)-4-[(4-isocyanophenyl)methoxy]pyrrolidine-2-carboxamide |
| SMILES | [C-]#[N+]c1ccc(CO[C@H]2CN[C@@H](C(=O)Nc3ccc(C#N)cc3)C2)cc1 |
| InChI | InChI=1S/C20H18N4O2/c1-22-16-6-4-15(5-7-16)13-26-18-10-19(23-12-18)20(25)24-17-8-2-14(11-21)3-9-17/h2-9,18-19,23H,10,12-13H2,(H,24,25)/t18-,19-/m1/s1 |
| InChIKey | BPUGVKJQVHAVAO-RTBURBONSA-N |
| XLogP | 2.99 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|