About 3,3-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptan-2-ol;methylsilane
3,3-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptan-2-ol;methylsilane (PubChem CID 123489658) has the molecular formula C11H21F3OSi
and a molecular weight of 254.37 g/mol. Its IUPAC name is 3,3-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptan-2-ol;methylsilane.
Molecular Properties
| Compound Name | 3,3-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptan-2-ol;methylsilane |
| PubChem CID | 123489658 |
| Molecular Formula | C11H21F3OSi |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 3,3-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptan-2-ol;methylsilane |
| SMILES | CC1(C)C2CCC(C2)C1(O)C(F)(F)F.C[SiH3] |
| InChI | InChI=1S/C10H15F3O.CH6Si/c1-8(2)6-3-4-7(5-6)9(8,14)10(11,12)13;1-2/h6-7,14H,3-5H2,1-2H3;1-2H3 |
| InChIKey | JHSZYOGBAWLLBR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptan-2-ol;methylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptan-2-ol;methylsilane?
The IUPAC name of 3,3-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptan-2-ol;methylsilane (CID 123489658) is 3,3-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptan-2-ol;methylsilane.
What is the SMILES notation for 3,3-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptan-2-ol;methylsilane?
The canonical SMILES for 3,3-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptan-2-ol;methylsilane is CC1(C)C2CCC(C2)C1(O)C(F)(F)F.C[SiH3].
What is the InChIKey of 3,3-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptan-2-ol;methylsilane?
The InChIKey is JHSZYOGBAWLLBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F3O.CH6Si/c1-8(2)6-3-4-7(5-6)9(8,14)10(11,12)13;1-2/h6-7,14H,3-5H2,1-2H3;1-2H3.
What are the key properties of 3,3-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptan-2-ol;methylsilane?
3,3-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptan-2-ol;methylsilane has a molecular weight of 254.37 g/mol, XLogP of 2.14, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptan-2-ol;methylsilane is sourced from PubChem (CID 123489658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).