About 1-chloro-3-ethyl-5-methoxy-2,3,5-trimethylhexane
1-chloro-3-ethyl-5-methoxy-2,3,5-trimethylhexane (PubChem CID 123489823) has the molecular formula C12H25ClO
and a molecular weight of 220.78 g/mol. Its IUPAC name is 1-chloro-3-ethyl-5-methoxy-2,3,5-trimethylhexane.
Molecular Properties
| Compound Name | 1-chloro-3-ethyl-5-methoxy-2,3,5-trimethylhexane |
| PubChem CID | 123489823 |
| Molecular Formula | C12H25ClO |
| Molecular Weight | 220.78 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 1-chloro-3-ethyl-5-methoxy-2,3,5-trimethylhexane |
| SMILES | CCC(C)(CC(C)(C)OC)C(C)CCl |
| InChI | InChI=1S/C12H25ClO/c1-7-12(5,10(2)8-13)9-11(3,4)14-6/h10H,7-9H2,1-6H3 |
| InChIKey | YMBUEHDGOZHYNZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.78 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3-ethyl-5-methoxy-2,3,5-trimethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-ethyl-5-methoxy-2,3,5-trimethylhexane?
The IUPAC name of 1-chloro-3-ethyl-5-methoxy-2,3,5-trimethylhexane (CID 123489823) is 1-chloro-3-ethyl-5-methoxy-2,3,5-trimethylhexane.
What is the SMILES notation for 1-chloro-3-ethyl-5-methoxy-2,3,5-trimethylhexane?
The canonical SMILES for 1-chloro-3-ethyl-5-methoxy-2,3,5-trimethylhexane is CCC(C)(CC(C)(C)OC)C(C)CCl.
What is the InChIKey of 1-chloro-3-ethyl-5-methoxy-2,3,5-trimethylhexane?
The InChIKey is YMBUEHDGOZHYNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25ClO/c1-7-12(5,10(2)8-13)9-11(3,4)14-6/h10H,7-9H2,1-6H3.
What are the key properties of 1-chloro-3-ethyl-5-methoxy-2,3,5-trimethylhexane?
1-chloro-3-ethyl-5-methoxy-2,3,5-trimethylhexane has a molecular weight of 220.78 g/mol, XLogP of 4.09, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-ethyl-5-methoxy-2,3,5-trimethylhexane is sourced from PubChem (CID 123489823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).