C19H31N3 — CID 123489930
1-ethenyl-N-methyl-N-[3-(2-methylpent-1-enyliminomethyl)buta-1,3-dienyl]piperidin-4-amine (PubChem CID 123489930) has the molecular formula C19H31N3 and a molecular weight of 301.48 g/mol. Its IUPAC name is 1-ethenyl-N-methyl-N-[3-(2-methylpent-1-enyliminomethyl)buta-1,3-dienyl]piperidin-4-amine.
| Compound Name | 1-ethenyl-N-methyl-N-[3-(2-methylpent-1-enyliminomethyl)buta-1,3-dienyl]piperidin-4-amine |
|---|---|
| PubChem CID | 123489930 |
| Molecular Formula | C19H31N3 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.25 |
| IUPAC Name | 1-ethenyl-N-methyl-N-[3-(2-methylpent-1-enyliminomethyl)buta-1,3-dienyl]piperidin-4-amine |
| SMILES | C=CN1CCC(N(C)C=CC(=C)/C=N/C=C(C)CCC)CC1 |
| InChI | InChI=1S/C19H31N3/c1-6-8-17(3)15-20-16-18(4)9-12-21(5)19-10-13-22(7-2)14-11-19/h7,9,12,15-16,19H,2,4,6,8,10-11,13-14H2,1,3,5H3/b12-9?,17-15?,20-16+ |
| InChIKey | BZWRWVYVBGOIMW-PKKWUNFJSA-N |
| XLogP | 4.37 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|