C20H16BrFN2O3 — CID 123490111
5-bromo-2-(5-fluoro-2-methoxyphenyl)-N'-hydroxy-3-(4-hydroxyphenyl)benzenecarboximidamide (PubChem CID 123490111) has the molecular formula C20H16BrFN2O3 and a molecular weight of 431.26 g/mol. Its IUPAC name is 5-bromo-2-(5-fluoro-2-methoxyphenyl)-N'-hydroxy-3-(4-hydroxyphenyl)benzenecarboximidamide.
| Compound Name | 5-bromo-2-(5-fluoro-2-methoxyphenyl)-N'-hydroxy-3-(4-hydroxyphenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 123490111 |
| Molecular Formula | C20H16BrFN2O3 |
| Molecular Weight | 431.26 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | 5-bromo-2-(5-fluoro-2-methoxyphenyl)-N'-hydroxy-3-(4-hydroxyphenyl)benzenecarboximidamide |
| SMILES | COc1ccc(F)cc1-c1c(C(N)=NO)cc(Br)cc1-c1ccc(O)cc1 |
| InChI | InChI=1S/C20H16BrFN2O3/c1-27-18-7-4-13(22)10-16(18)19-15(11-2-5-14(25)6-3-11)8-12(21)9-17(19)20(23)24-26/h2-10,25-26H,1H3,(H2,23,24) |
| InChIKey | ORCBQCLTIBLMDO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.26 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|