C17H19FN2O2 — CID 123490166
butyl N-[4-(4-fluoro-2-methylphenyl)-3-pyridinyl]carbamate (PubChem CID 123490166) has the molecular formula C17H19FN2O2 and a molecular weight of 302.35 g/mol. Its IUPAC name is butyl N-[4-(4-fluoro-2-methylphenyl)-3-pyridinyl]carbamate.
| Compound Name | butyl N-[4-(4-fluoro-2-methylphenyl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 123490166 |
| Molecular Formula | C17H19FN2O2 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | butyl N-[4-(4-fluoro-2-methylphenyl)-3-pyridinyl]carbamate |
| SMILES | CCCCOC(=O)Nc1cnccc1-c1ccc(F)cc1C |
| InChI | InChI=1S/C17H19FN2O2/c1-3-4-9-22-17(21)20-16-11-19-8-7-15(16)14-6-5-13(18)10-12(14)2/h5-8,10-11H,3-4,9H2,1-2H3,(H,20,21) |
| InChIKey | UFMPUOZOGIKWAM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|