C29H44ClNO9Si — CID 123490259
2-[[(1Z,3E)-1-[2-chloro-3,5-bis(ethoxymethoxy)-6-(2-trimethylsilylethoxycarbonyl)phenyl]-6-methylocta-1,3,7-trien-2-yl]amino]oxyacetic acid (PubChem CID 123490259) has the molecular formula C29H44ClNO9Si and a molecular weight of 614.21 g/mol. Its IUPAC name is 2-[[(1Z,3E)-1-[2-chloro-3,5-bis(ethoxymethoxy)-6-(2-trimethylsilylethoxycarbonyl)phenyl]-6-methylocta-1,3,7-trien-2-yl]amino]oxyacetic acid.
| Compound Name | 2-[[(1Z,3E)-1-[2-chloro-3,5-bis(ethoxymethoxy)-6-(2-trimethylsilylethoxycarbonyl)phenyl]-6-methylocta-1,3,7-trien-2-yl]amino]oxyacetic acid |
|---|---|
| PubChem CID | 123490259 |
| Molecular Formula | C29H44ClNO9Si |
| Molecular Weight | 614.21 g/mol |
| Exact Mass | 613.25 |
| IUPAC Name | 2-[[(1Z,3E)-1-[2-chloro-3,5-bis(ethoxymethoxy)-6-(2-trimethylsilylethoxycarbonyl)phenyl]-6-methylocta-1,3,7-trien-2-yl]amino]oxyacetic acid |
| SMILES | C=CC(C)C/C=C/C(=C/c1c(Cl)c(OCOCC)cc(OCOCC)c1C(=O)OCC[Si](C)(C)C)NOCC(=O)O |
| InChI | InChI=1S/C29H44ClNO9Si/c1-8-21(4)12-11-13-22(31-40-18-26(32)33)16-23-27(29(34)37-14-15-41(5,6)7)24(38-19-35-9-2)17-25(28(23)30)39-20-36-10-3/h8,11,13,16-17,21,31H,1,9-10,12,14-15,18-20H2,2-7H3,(H,32,33)/b13-11+,22-16- |
| InChIKey | LRFBHTXAQWTYJF-YLEGLNDPSA-N |
| XLogP | 6.30 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.21 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|