About 3-cyclobutylbuta-1,3-dienyl-ethylidene-methyl-λ4-sulfane
3-cyclobutylbuta-1,3-dienyl-ethylidene-methyl-λ4-sulfane (PubChem CID 123490366) has the molecular formula C11H18S
and a molecular weight of 182.33 g/mol. Its IUPAC name is 3-cyclobutylbuta-1,3-dienyl-ethylidene-methyl-λ4-sulfane.
Molecular Properties
| Compound Name | 3-cyclobutylbuta-1,3-dienyl-ethylidene-methyl-λ4-sulfane |
| PubChem CID | 123490366 |
| Molecular Formula | C11H18S |
| Molecular Weight | 182.33 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 3-cyclobutylbuta-1,3-dienyl-ethylidene-methyl-λ4-sulfane |
| SMILES | C=C(C=CS(C)=CC)C1CCC1 |
| InChI | InChI=1S/C11H18S/c1-4-12(3)9-8-10(2)11-6-5-7-11/h4,8-9,11H,2,5-7H2,1,3H3 |
| InChIKey | XRCJVZONQBPNMC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclobutylbuta-1,3-dienyl-ethylidene-methyl-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclobutylbuta-1,3-dienyl-ethylidene-methyl-λ4-sulfane?
The IUPAC name of 3-cyclobutylbuta-1,3-dienyl-ethylidene-methyl-λ4-sulfane (CID 123490366) is 3-cyclobutylbuta-1,3-dienyl-ethylidene-methyl-λ4-sulfane.
What is the SMILES notation for 3-cyclobutylbuta-1,3-dienyl-ethylidene-methyl-λ4-sulfane?
The canonical SMILES for 3-cyclobutylbuta-1,3-dienyl-ethylidene-methyl-λ4-sulfane is C=C(C=CS(C)=CC)C1CCC1.
What is the InChIKey of 3-cyclobutylbuta-1,3-dienyl-ethylidene-methyl-λ4-sulfane?
The InChIKey is XRCJVZONQBPNMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18S/c1-4-12(3)9-8-10(2)11-6-5-7-11/h4,8-9,11H,2,5-7H2,1,3H3.
What are the key properties of 3-cyclobutylbuta-1,3-dienyl-ethylidene-methyl-λ4-sulfane?
3-cyclobutylbuta-1,3-dienyl-ethylidene-methyl-λ4-sulfane has a molecular weight of 182.33 g/mol, XLogP of 3.58, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclobutylbuta-1,3-dienyl-ethylidene-methyl-λ4-sulfane is sourced from PubChem (CID 123490366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).