About 8-(2,2-difluoroethyl)-3-methyl-8-azabicyclo[3.2.1]octane
8-(2,2-difluoroethyl)-3-methyl-8-azabicyclo[3.2.1]octane (PubChem CID 123490402) has the molecular formula C10H17F2N
and a molecular weight of 189.25 g/mol. Its IUPAC name is 8-(2,2-difluoroethyl)-3-methyl-8-azabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | 8-(2,2-difluoroethyl)-3-methyl-8-azabicyclo[3.2.1]octane |
| PubChem CID | 123490402 |
| Molecular Formula | C10H17F2N |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 8-(2,2-difluoroethyl)-3-methyl-8-azabicyclo[3.2.1]octane |
| SMILES | CC1CC2CCC(C1)N2CC(F)F |
| InChI | InChI=1S/C10H17F2N/c1-7-4-8-2-3-9(5-7)13(8)6-10(11)12/h7-10H,2-6H2,1H3 |
| InChIKey | XIFLEDORJMCZGS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-(2,2-difluoroethyl)-3-methyl-8-azabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2,2-difluoroethyl)-3-methyl-8-azabicyclo[3.2.1]octane?
The IUPAC name of 8-(2,2-difluoroethyl)-3-methyl-8-azabicyclo[3.2.1]octane (CID 123490402) is 8-(2,2-difluoroethyl)-3-methyl-8-azabicyclo[3.2.1]octane.
What is the SMILES notation for 8-(2,2-difluoroethyl)-3-methyl-8-azabicyclo[3.2.1]octane?
The canonical SMILES for 8-(2,2-difluoroethyl)-3-methyl-8-azabicyclo[3.2.1]octane is CC1CC2CCC(C1)N2CC(F)F.
What is the InChIKey of 8-(2,2-difluoroethyl)-3-methyl-8-azabicyclo[3.2.1]octane?
The InChIKey is XIFLEDORJMCZGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2N/c1-7-4-8-2-3-9(5-7)13(8)6-10(11)12/h7-10H,2-6H2,1H3.
What are the key properties of 8-(2,2-difluoroethyl)-3-methyl-8-azabicyclo[3.2.1]octane?
8-(2,2-difluoroethyl)-3-methyl-8-azabicyclo[3.2.1]octane has a molecular weight of 189.25 g/mol, XLogP of 2.51, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2,2-difluoroethyl)-3-methyl-8-azabicyclo[3.2.1]octane is sourced from PubChem (CID 123490402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).