C8H8N2O — CID 123490481
7,8-dihydro-1H-quinazolin-2-one (PubChem CID 123490481) has the molecular formula C8H8N2O and a molecular weight of 148.16 g/mol. Its IUPAC name is 7,8-dihydro-1H-quinazolin-2-one.
| Compound Name | 7,8-dihydro-1H-quinazolin-2-one |
|---|---|
| PubChem CID | 123490481 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 7,8-dihydro-1H-quinazolin-2-one |
| SMILES | O=c1ncc2c([nH]1)CCC=C2 |
| InChI | InChI=1S/C8H8N2O/c11-8-9-5-6-3-1-2-4-7(6)10-8/h1,3,5H,2,4H2,(H,9,10,11) |
| InChIKey | ZYSAQSQGKYFVGR-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |