About 2-tert-butyl-2,4-dimethyl-1-oct-4-en-3-yloxypentan-1-ol
2-tert-butyl-2,4-dimethyl-1-oct-4-en-3-yloxypentan-1-ol (PubChem CID 123490568) has the molecular formula C19H38O2
and a molecular weight of 298.51 g/mol. Its IUPAC name is 2-tert-butyl-2,4-dimethyl-1-oct-4-en-3-yloxypentan-1-ol.
Molecular Properties
| Compound Name | 2-tert-butyl-2,4-dimethyl-1-oct-4-en-3-yloxypentan-1-ol |
| PubChem CID | 123490568 |
| Molecular Formula | C19H38O2 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.29 |
| IUPAC Name | 2-tert-butyl-2,4-dimethyl-1-oct-4-en-3-yloxypentan-1-ol |
| SMILES | CCCC=CC(CC)OC(O)C(C)(CC(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H38O2/c1-9-11-12-13-16(10-2)21-17(20)19(8,14-15(3)4)18(5,6)7/h12-13,15-17,20H,9-11,14H2,1-8H3 |
| InChIKey | RXMICZHSKLMFIS-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-2,4-dimethyl-1-oct-4-en-3-yloxypentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-2,4-dimethyl-1-oct-4-en-3-yloxypentan-1-ol?
The IUPAC name of 2-tert-butyl-2,4-dimethyl-1-oct-4-en-3-yloxypentan-1-ol (CID 123490568) is 2-tert-butyl-2,4-dimethyl-1-oct-4-en-3-yloxypentan-1-ol.
What is the SMILES notation for 2-tert-butyl-2,4-dimethyl-1-oct-4-en-3-yloxypentan-1-ol?
The canonical SMILES for 2-tert-butyl-2,4-dimethyl-1-oct-4-en-3-yloxypentan-1-ol is CCCC=CC(CC)OC(O)C(C)(CC(C)C)C(C)(C)C.
What is the InChIKey of 2-tert-butyl-2,4-dimethyl-1-oct-4-en-3-yloxypentan-1-ol?
The InChIKey is RXMICZHSKLMFIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38O2/c1-9-11-12-13-16(10-2)21-17(20)19(8,14-15(3)4)18(5,6)7/h12-13,15-17,20H,9-11,14H2,1-8H3.
What are the key properties of 2-tert-butyl-2,4-dimethyl-1-oct-4-en-3-yloxypentan-1-ol?
2-tert-butyl-2,4-dimethyl-1-oct-4-en-3-yloxypentan-1-ol has a molecular weight of 298.51 g/mol, XLogP of 5.55, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-2,4-dimethyl-1-oct-4-en-3-yloxypentan-1-ol is sourced from PubChem (CID 123490568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).