C24H24N2O4S — CID 123490715
N-[[7-(4-methylperoxysulfanylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-pyridin-2-ylpropanamide (PubChem CID 123490715) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is N-[[7-(4-methylperoxysulfanylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-pyridin-2-ylpropanamide.
| Compound Name | N-[[7-(4-methylperoxysulfanylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 123490715 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | N-[[7-(4-methylperoxysulfanylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-pyridin-2-ylpropanamide |
| SMILES | COOSc1ccc(-c2cccc3c2OC(CNC(=O)CCc2ccccn2)C3)cc1 |
| InChI | InChI=1S/C24H24N2O4S/c1-28-30-31-21-11-8-17(9-12-21)22-7-4-5-18-15-20(29-24(18)22)16-26-23(27)13-10-19-6-2-3-14-25-19/h2-9,11-12,14,20H,10,13,15-16H2,1H3,(H,26,27) |
| InChIKey | RALHZJDUSOKTQG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|