C24H22F2N3O7PS — CID 123491154
[4-[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonylmethyl]phenyl]phosphonic acid (PubChem CID 123491154) has the molecular formula C24H22F2N3O7PS and a molecular weight of 565.49 g/mol. Its IUPAC name is [4-[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonylmethyl]phenyl]phosphonic acid.
| Compound Name | [4-[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonylmethyl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 123491154 |
| Molecular Formula | C24H22F2N3O7PS |
| Molecular Weight | 565.49 g/mol |
| Exact Mass | 565.09 |
| IUPAC Name | [4-[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonylmethyl]phenyl]phosphonic acid |
| SMILES | C/C(=C\c1cc(F)c(Oc2ccc(S(=O)(=O)Cc3ccc(P(=O)(O)O)cc3)cc2)c(F)c1)C(=O)N=C(N)N |
| InChI | InChI=1S/C24H22F2N3O7PS/c1-14(23(30)29-24(27)28)10-16-11-20(25)22(21(26)12-16)36-17-4-8-19(9-5-17)38(34,35)13-15-2-6-18(7-3-15)37(31,32)33/h2-12H,13H2,1H3,(H2,31,32,33)(H4,27,28,29,30)/b14-10+ |
| InChIKey | NBITYDUHUPQCKT-GXDHUFHOSA-N |
| XLogP | 2.74 |
| TPSA | 182.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|