C21H40O6Si — CID 123491652
methyl 4-[6-[tert-butyl(methyl)silyl]oxy-5-(dimethoxymethyl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl]butanoate (PubChem CID 123491652) has the molecular formula C21H40O6Si and a molecular weight of 416.63 g/mol. Its IUPAC name is methyl 4-[6-[tert-butyl(methyl)silyl]oxy-5-(dimethoxymethyl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl]butanoate.
| Compound Name | methyl 4-[6-[tert-butyl(methyl)silyl]oxy-5-(dimethoxymethyl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl]butanoate |
|---|---|
| PubChem CID | 123491652 |
| Molecular Formula | C21H40O6Si |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | methyl 4-[6-[tert-butyl(methyl)silyl]oxy-5-(dimethoxymethyl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl]butanoate |
| SMILES | COC(=O)CCCC1CC2CC(C(OC)OC)C(O[SiH](C)C(C)(C)C)CC2O1 |
| InChI | InChI=1S/C21H40O6Si/c1-21(2,3)28(7)27-18-13-17-14(12-16(18)20(24-5)25-6)11-15(26-17)9-8-10-19(22)23-4/h14-18,20,28H,8-13H2,1-7H3 |
| InChIKey | PLTDBOZOCOPDHV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|