C24H34BNO5 — CID 123491981
2-hydroxy-2-[(2S,3S)-3-methyl-3-phenyloxiran-2-yl]-3-(2-oxopropyl)-3-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1-oxa-3-azonia-2-boranuidacyclopentan-5-one (PubChem CID 123491981) has the molecular formula C24H34BNO5 and a molecular weight of 427.35 g/mol. Its IUPAC name is 2-hydroxy-2-[(2S,3S)-3-methyl-3-phenyloxiran-2-yl]-3-(2-oxopropyl)-3-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1-oxa-3-azonia-2-boranuidacyclopentan-5-one.
| Compound Name | 2-hydroxy-2-[(2S,3S)-3-methyl-3-phenyloxiran-2-yl]-3-(2-oxopropyl)-3-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1-oxa-3-azonia-2-boranuidacyclopentan-5-one |
|---|---|
| PubChem CID | 123491981 |
| Molecular Formula | C24H34BNO5 |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 2-hydroxy-2-[(2S,3S)-3-methyl-3-phenyloxiran-2-yl]-3-(2-oxopropyl)-3-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1-oxa-3-azonia-2-boranuidacyclopentan-5-one |
| SMILES | CC(=O)C[N+]1([C@@H]2C[C@@H]3C[C@H]([C@H]2C)C3(C)C)CC(=O)O[B-]1(O)[C@@H]1O[C@@]1(C)c1ccccc1 |
| InChI | InChI=1S/C24H34BNO5/c1-15(27)13-26(20-12-18-11-19(16(20)2)23(18,3)4)14-21(28)31-25(26,29)22-24(5,30-22)17-9-7-6-8-10-17/h6-10,16,18-20,22,29H,11-14H2,1-5H3/t16-,18+,19-,20-,22-,24+,25?,26?/m1/s1 |
| InChIKey | WQVDBRCMBBMUGI-FUNZYABASA-N |
| XLogP | 2.80 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|