C21H27FN6O3S — CID 123492147
2-[6-(4-cyclopropylsulfonylpiperazin-1-yl)pyrimidine-4-carboximidoyl]-5-fluoro-4-propan-2-yloxyaniline (PubChem CID 123492147) has the molecular formula C21H27FN6O3S and a molecular weight of 462.55 g/mol. Its IUPAC name is 2-[6-(4-cyclopropylsulfonylpiperazin-1-yl)pyrimidine-4-carboximidoyl]-5-fluoro-4-propan-2-yloxyaniline.
| Compound Name | 2-[6-(4-cyclopropylsulfonylpiperazin-1-yl)pyrimidine-4-carboximidoyl]-5-fluoro-4-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 123492147 |
| Molecular Formula | C21H27FN6O3S |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 2-[6-(4-cyclopropylsulfonylpiperazin-1-yl)pyrimidine-4-carboximidoyl]-5-fluoro-4-propan-2-yloxyaniline |
| SMILES | [H]/N=C(\c1cc(N2CCN(S(=O)(=O)C3CC3)CC2)ncn1)c1cc(OC(C)C)c(F)cc1N |
| InChI | InChI=1S/C21H27FN6O3S/c1-13(2)31-19-9-15(17(23)10-16(19)22)21(24)18-11-20(26-12-25-18)27-5-7-28(8-6-27)32(29,30)14-3-4-14/h9-14,24H,3-8,23H2,1-2H3/b24-21- |
| InChIKey | ZKNUFNWYRHPJID-FLFQWRMESA-N |
| XLogP | 2.02 |
| TPSA | 125.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|