About (5-methylcyclohepta-1,3,6-trien-1-yl)diazene
(5-methylcyclohepta-1,3,6-trien-1-yl)diazene (PubChem CID 123492209) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is (5-methylcyclohepta-1,3,6-trien-1-yl)diazene.
Molecular Properties
| Compound Name | (5-methylcyclohepta-1,3,6-trien-1-yl)diazene |
| PubChem CID | 123492209 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | (5-methylcyclohepta-1,3,6-trien-1-yl)diazene |
| SMILES | [H]/N=N/C1=CC=CC(C)C=C1 |
| InChI | InChI=1S/C8H10N2/c1-7-3-2-4-8(10-9)6-5-7/h2-7,9H,1H3/b10-9+ |
| InChIKey | BKAUNMAXTYAPTM-MDZDMXLPSA-N |
| XLogP | 2.66 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (5-methylcyclohepta-1,3,6-trien-1-yl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methylcyclohepta-1,3,6-trien-1-yl)diazene?
The IUPAC name of (5-methylcyclohepta-1,3,6-trien-1-yl)diazene (CID 123492209) is (5-methylcyclohepta-1,3,6-trien-1-yl)diazene.
What is the SMILES notation for (5-methylcyclohepta-1,3,6-trien-1-yl)diazene?
The canonical SMILES for (5-methylcyclohepta-1,3,6-trien-1-yl)diazene is [H]/N=N/C1=CC=CC(C)C=C1.
What is the InChIKey of (5-methylcyclohepta-1,3,6-trien-1-yl)diazene?
The InChIKey is BKAUNMAXTYAPTM-MDZDMXLPSA-N. The full InChI is InChI=1S/C8H10N2/c1-7-3-2-4-8(10-9)6-5-7/h2-7,9H,1H3/b10-9+.
What are the key properties of (5-methylcyclohepta-1,3,6-trien-1-yl)diazene?
(5-methylcyclohepta-1,3,6-trien-1-yl)diazene has a molecular weight of 134.18 g/mol, XLogP of 2.66, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methylcyclohepta-1,3,6-trien-1-yl)diazene is sourced from PubChem (CID 123492209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).