C25H44O4 — CID 123492932
7-(1-methoxy-2-methylpropoxy)octa-3,5,7-trien-4-yl 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 123492932) has the molecular formula C25H44O4 and a molecular weight of 408.62 g/mol. Its IUPAC name is 7-(1-methoxy-2-methylpropoxy)octa-3,5,7-trien-4-yl 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | 7-(1-methoxy-2-methylpropoxy)octa-3,5,7-trien-4-yl 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 123492932 |
| Molecular Formula | C25H44O4 |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.32 |
| IUPAC Name | 7-(1-methoxy-2-methylpropoxy)octa-3,5,7-trien-4-yl 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | C=C(C=CC(=CCC)OC(=O)C(C)(CC(C)(C)C)C(C)(C)C)OC(OC)C(C)C |
| InChI | InChI=1S/C25H44O4/c1-13-14-20(16-15-19(4)28-21(27-12)18(2)3)29-22(26)25(11,24(8,9)10)17-23(5,6)7/h14-16,18,21H,4,13,17H2,1-3,5-12H3 |
| InChIKey | JXUMOKYVBDFSKO-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|