C26H43ClN2O2 — CID 123493076
methyl 4-[(2R)-1-[(4R)-4-(4-chlorocyclohexyl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]iminocyclohex-2-ene-1-carboxylate (PubChem CID 123493076) has the molecular formula C26H43ClN2O2 and a molecular weight of 451.10 g/mol. Its IUPAC name is methyl 4-[(2R)-1-[(4R)-4-(4-chlorocyclohexyl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]iminocyclohex-2-ene-1-carboxylate.
| Compound Name | methyl 4-[(2R)-1-[(4R)-4-(4-chlorocyclohexyl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]iminocyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 123493076 |
| Molecular Formula | C26H43ClN2O2 |
| Molecular Weight | 451.10 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | methyl 4-[(2R)-1-[(4R)-4-(4-chlorocyclohexyl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]iminocyclohex-2-ene-1-carboxylate |
| SMILES | COC(=O)C1C=C/C(=N/[C@@H](CN2CC[C@H](C3CCC(Cl)CC3)C(C)(C)C2)C(C)C)CC1 |
| InChI | InChI=1S/C26H43ClN2O2/c1-18(2)24(28-22-12-8-20(9-13-22)25(30)31-5)16-29-15-14-23(26(3,4)17-29)19-6-10-21(27)11-7-19/h8,12,18-21,23-24H,6-7,9-11,13-17H2,1-5H3/b28-22-/t19?,20?,21?,23-,24+/m1/s1 |
| InChIKey | IFMMEBFLVNUSGV-NMICOLQVSA-N |
| XLogP | 5.74 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.10 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|