About 2-methylcyclododeca-4,8-dien-1-one
2-methylcyclododeca-4,8-dien-1-one (PubChem CID 123493270) has the molecular formula C13H20O
and a molecular weight of 192.30 g/mol. Its IUPAC name is 2-methylcyclododeca-4,8-dien-1-one.
Molecular Properties
| Compound Name | 2-methylcyclododeca-4,8-dien-1-one |
| PubChem CID | 123493270 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 2-methylcyclododeca-4,8-dien-1-one |
| SMILES | CC1CC=CCCC=CCCCC1=O |
| InChI | InChI=1S/C13H20O/c1-12-10-8-6-4-2-3-5-7-9-11-13(12)14/h3,5-6,8,12H,2,4,7,9-11H2,1H3 |
| InChIKey | UBAJJFZCIDARAB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylcyclododeca-4,8-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylcyclododeca-4,8-dien-1-one?
The IUPAC name of 2-methylcyclododeca-4,8-dien-1-one (CID 123493270) is 2-methylcyclododeca-4,8-dien-1-one.
What is the SMILES notation for 2-methylcyclododeca-4,8-dien-1-one?
The canonical SMILES for 2-methylcyclododeca-4,8-dien-1-one is CC1CC=CCCC=CCCCC1=O.
What is the InChIKey of 2-methylcyclododeca-4,8-dien-1-one?
The InChIKey is UBAJJFZCIDARAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O/c1-12-10-8-6-4-2-3-5-7-9-11-13(12)14/h3,5-6,8,12H,2,4,7,9-11H2,1H3.
What are the key properties of 2-methylcyclododeca-4,8-dien-1-one?
2-methylcyclododeca-4,8-dien-1-one has a molecular weight of 192.30 g/mol, XLogP of 3.66, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylcyclododeca-4,8-dien-1-one is sourced from PubChem (CID 123493270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).