C25H38N2O2 — CID 123493465
N-(1-adamantyl)-6-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-6-oxohexanamide (PubChem CID 123493465) has the molecular formula C25H38N2O2 and a molecular weight of 398.59 g/mol. Its IUPAC name is N-(1-adamantyl)-6-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-6-oxohexanamide.
| Compound Name | N-(1-adamantyl)-6-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-6-oxohexanamide |
|---|---|
| PubChem CID | 123493465 |
| Molecular Formula | C25H38N2O2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | N-(1-adamantyl)-6-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-6-oxohexanamide |
| SMILES | O=C(CCCCC(=O)N1CCCC2CCCC=C21)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H38N2O2/c28-23(26-25-15-18-12-19(16-25)14-20(13-18)17-25)9-3-4-10-24(29)27-11-5-7-21-6-1-2-8-22(21)27/h8,18-21H,1-7,9-17H2,(H,26,28) |
| InChIKey | FWELOASNZKLANZ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|