C17H22NO10P — CID 123493585
[1,3-dihydroxy-2-[2-(2-phosphonooxyethoxy)ethyl]-7H-4,7-epoxyisoindol-4-yl]methyl 2-methylprop-2-enoate (PubChem CID 123493585) has the molecular formula C17H22NO10P and a molecular weight of 431.33 g/mol. Its IUPAC name is [1,3-dihydroxy-2-[2-(2-phosphonooxyethoxy)ethyl]-7H-4,7-epoxyisoindol-4-yl]methyl 2-methylprop-2-enoate.
| Compound Name | [1,3-dihydroxy-2-[2-(2-phosphonooxyethoxy)ethyl]-7H-4,7-epoxyisoindol-4-yl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123493585 |
| Molecular Formula | C17H22NO10P |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | [1,3-dihydroxy-2-[2-(2-phosphonooxyethoxy)ethyl]-7H-4,7-epoxyisoindol-4-yl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC12C=CC(O1)c1c2c(O)n(CCOCCOP(=O)(O)O)c1O |
| InChI | InChI=1S/C17H22NO10P/c1-10(2)16(21)26-9-17-4-3-11(28-17)12-13(17)15(20)18(14(12)19)5-6-25-7-8-27-29(22,23)24/h3-4,11,19-20H,1,5-9H2,2H3,(H2,22,23,24) |
| InChIKey | KZUWQGDOJQRROK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|