About N'-[(3Z)-5-oxohexa-1,3-dien-2-yl]adamantane-1-carboximidamide
N'-[(3Z)-5-oxohexa-1,3-dien-2-yl]adamantane-1-carboximidamide (PubChem CID 123493600) has the molecular formula C17H24N2O
and a molecular weight of 272.39 g/mol. Its IUPAC name is N'-[(3Z)-5-oxohexa-1,3-dien-2-yl]adamantane-1-carboximidamide.
Molecular Properties
| Compound Name | N'-[(3Z)-5-oxohexa-1,3-dien-2-yl]adamantane-1-carboximidamide |
| PubChem CID | 123493600 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | N'-[(3Z)-5-oxohexa-1,3-dien-2-yl]adamantane-1-carboximidamide |
| SMILES | C=C(/C=C\C(C)=O)/N=C(\N)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H24N2O/c1-11(3-4-12(2)20)19-16(18)17-8-13-5-14(9-17)7-15(6-13)10-17/h3-4,13-15H,1,5-10H2,2H3,(H2,18,19)/b4-3- |
| InChIKey | NIWKWHDYUXGZAI-ARJAWSKDSA-N |
| XLogP | 3.22 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-[(3Z)-5-oxohexa-1,3-dien-2-yl]adamantane-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(3Z)-5-oxohexa-1,3-dien-2-yl]adamantane-1-carboximidamide?
The IUPAC name of N'-[(3Z)-5-oxohexa-1,3-dien-2-yl]adamantane-1-carboximidamide (CID 123493600) is N'-[(3Z)-5-oxohexa-1,3-dien-2-yl]adamantane-1-carboximidamide.
What is the SMILES notation for N'-[(3Z)-5-oxohexa-1,3-dien-2-yl]adamantane-1-carboximidamide?
The canonical SMILES for N'-[(3Z)-5-oxohexa-1,3-dien-2-yl]adamantane-1-carboximidamide is C=C(/C=C\C(C)=O)/N=C(\N)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of N'-[(3Z)-5-oxohexa-1,3-dien-2-yl]adamantane-1-carboximidamide?
The InChIKey is NIWKWHDYUXGZAI-ARJAWSKDSA-N. The full InChI is InChI=1S/C17H24N2O/c1-11(3-4-12(2)20)19-16(18)17-8-13-5-14(9-17)7-15(6-13)10-17/h3-4,13-15H,1,5-10H2,2H3,(H2,18,19)/b4-3-.
What are the key properties of N'-[(3Z)-5-oxohexa-1,3-dien-2-yl]adamantane-1-carboximidamide?
N'-[(3Z)-5-oxohexa-1,3-dien-2-yl]adamantane-1-carboximidamide has a molecular weight of 272.39 g/mol, XLogP of 3.22, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(3Z)-5-oxohexa-1,3-dien-2-yl]adamantane-1-carboximidamide is sourced from PubChem (CID 123493600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).