C18H23N3O4S — CID 123493788
5-[[2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-4,5-dimethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 123493788) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is 5-[[2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-4,5-dimethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-4,5-dimethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 123493788 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 5-[[2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-4,5-dimethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(C=C2SC(=O)NC2=O)c(N2CC[C@H](N(C)C)C2)cc1OC |
| InChI | InChI=1S/C18H23N3O4S/c1-20(2)12-5-6-21(10-12)13-9-15(25-4)14(24-3)7-11(13)8-16-17(22)19-18(23)26-16/h7-9,12H,5-6,10H2,1-4H3,(H,19,22,23)/t12-/m0/s1 |
| InChIKey | NQGWOFHMANFLJC-LBPRGKRZSA-N |
| XLogP | 2.17 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|