C17H13ClF3N5OS — CID 123493861
N-carbamothioyl-2-[(3-chlorophenyl)diazenyl]-3-imino-3-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 123493861) has the molecular formula C17H13ClF3N5OS and a molecular weight of 427.84 g/mol. Its IUPAC name is N-carbamothioyl-2-[(3-chlorophenyl)diazenyl]-3-imino-3-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | N-carbamothioyl-2-[(3-chlorophenyl)diazenyl]-3-imino-3-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 123493861 |
| Molecular Formula | C17H13ClF3N5OS |
| Molecular Weight | 427.84 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | N-carbamothioyl-2-[(3-chlorophenyl)diazenyl]-3-imino-3-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | [H]/N=C(\c1ccc(C(F)(F)F)cc1)C(/N=N/c1cccc(Cl)c1)C(=O)NC(N)=S |
| InChI | InChI=1S/C17H13ClF3N5OS/c18-11-2-1-3-12(8-11)25-26-14(15(27)24-16(23)28)13(22)9-4-6-10(7-5-9)17(19,20)21/h1-8,14,22H,(H3,23,24,27,28)/b22-13+,26-25+ |
| InChIKey | TVJIHCQZIXAYBZ-BVHOLXRCSA-N |
| XLogP | 4.24 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.84 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|