About 1-bicyclo[2.2.1]heptanyl hydrogen sulfite
1-bicyclo[2.2.1]heptanyl hydrogen sulfite (PubChem CID 123493978) has the molecular formula C7H12O3S
and a molecular weight of 176.24 g/mol. Its IUPAC name is 1-bicyclo[2.2.1]heptanyl hydrogen sulfite.
Molecular Properties
| Compound Name | 1-bicyclo[2.2.1]heptanyl hydrogen sulfite |
| PubChem CID | 123493978 |
| Molecular Formula | C7H12O3S |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | 1-bicyclo[2.2.1]heptanyl hydrogen sulfite |
| SMILES | O=S(O)OC12CCC(CC1)C2 |
| InChI | InChI=1S/C7H12O3S/c8-11(9)10-7-3-1-6(5-7)2-4-7/h6H,1-5H2,(H,8,9) |
| InChIKey | MUPNJMWJVSQLQT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-bicyclo[2.2.1]heptanyl hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bicyclo[2.2.1]heptanyl hydrogen sulfite?
The IUPAC name of 1-bicyclo[2.2.1]heptanyl hydrogen sulfite (CID 123493978) is 1-bicyclo[2.2.1]heptanyl hydrogen sulfite.
What is the SMILES notation for 1-bicyclo[2.2.1]heptanyl hydrogen sulfite?
The canonical SMILES for 1-bicyclo[2.2.1]heptanyl hydrogen sulfite is O=S(O)OC12CCC(CC1)C2.
What is the InChIKey of 1-bicyclo[2.2.1]heptanyl hydrogen sulfite?
The InChIKey is MUPNJMWJVSQLQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3S/c8-11(9)10-7-3-1-6(5-7)2-4-7/h6H,1-5H2,(H,8,9).
What are the key properties of 1-bicyclo[2.2.1]heptanyl hydrogen sulfite?
1-bicyclo[2.2.1]heptanyl hydrogen sulfite has a molecular weight of 176.24 g/mol, XLogP of 1.47, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bicyclo[2.2.1]heptanyl hydrogen sulfite is sourced from PubChem (CID 123493978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).